C17H17ClO4 — CID 20988227
5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzoic acid (PubChem CID 20988227) has the molecular formula C17H17ClO4 and a molecular weight of 320.77 g/mol. Its IUPAC name is 5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzoic acid.
| Compound Name | 5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 20988227 |
| Molecular Formula | C17H17ClO4 |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzoic acid |
| SMILES | Cc1cccc(OCCOc2ccc(Cl)cc2C(=O)O)c1C |
| InChI | InChI=1S/C17H17ClO4/c1-11-4-3-5-15(12(11)2)21-8-9-22-16-7-6-13(18)10-14(16)17(19)20/h3-7,10H,8-9H2,1-2H3,(H,19,20) |
| InChIKey | OANITFRYZNKLMY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|