C20H20ClN5O2 — CID 12986294
[4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl] N,N-diethylcarbamate (PubChem CID 12986294) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is [4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl] N,N-diethylcarbamate.
| Compound Name | [4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 12986294 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [4-[6-(3-chloroanilino)pyrazin-2-yl]-3-pyridinyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cnccc1-c1cncc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C20H20ClN5O2/c1-3-26(4-2)20(27)28-18-12-22-9-8-16(18)17-11-23-13-19(25-17)24-15-7-5-6-14(21)10-15/h5-13H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | NXPPVOSPEPIDRP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |