C16H15ClN6OS — CID 87654657
1-[3-(3-chloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea (PubChem CID 87654657) has the molecular formula C16H15ClN6OS and a molecular weight of 374.86 g/mol. Its IUPAC name is 1-[3-(3-chloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea.
| Compound Name | 1-[3-(3-chloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea |
|---|---|
| PubChem CID | 87654657 |
| Molecular Formula | C16H15ClN6OS |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[3-(3-chloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea |
| SMILES | CCNC(=O)N(S)c1ccc2ncc(Nc3cccc(Cl)c3)nc2n1 |
| InChI | InChI=1S/C16H15ClN6OS/c1-2-18-16(24)23(25)14-7-6-12-15(22-14)21-13(9-19-12)20-11-5-3-4-10(17)8-11/h3-9,25H,2H2,1H3,(H,18,24)(H,20,21,22) |
| InChIKey | IYDHGQRCSNGQAP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|