C19H13ClN4 — CID 22725052
N-(3-chlorophenyl)-3-phenylpyrido[2,3-b]pyrazin-6-amine (PubChem CID 22725052) has the molecular formula C19H13ClN4 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-phenylpyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(3-chlorophenyl)-3-phenylpyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 22725052 |
| Molecular Formula | C19H13ClN4 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(3-chlorophenyl)-3-phenylpyrido[2,3-b]pyrazin-6-amine |
| SMILES | Clc1cccc(Nc2ccc3ncc(-c4ccccc4)nc3n2)c1 |
| InChI | InChI=1S/C19H13ClN4/c20-14-7-4-8-15(11-14)22-18-10-9-16-19(24-18)23-17(12-21-16)13-5-2-1-3-6-13/h1-12H,(H,22,23,24) |
| InChIKey | QCPKHOKMOYDCRB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |