C19H17ClN4 — CID 112879658
4-N-(3-chlorophenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 112879658) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879658 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1cc(Nc2cccc(Cl)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H17ClN4/c1-2-11-21-17-13-18(22-16-10-6-9-15(20)12-16)24-19(23-17)14-7-4-3-5-8-14/h2-10,12-13H,1,11H2,(H2,21,22,23,24) |
| InChIKey | HLWXFCJOMLXEDI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|