C20H16ClFN4O — CID 112852048
N-(3-chloro-4-fluorophenyl)-2-phenyl-6-(prop-2-enylamino)pyrimidine-4-carboxamide (PubChem CID 112852048) has the molecular formula C20H16ClFN4O and a molecular weight of 382.83 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-phenyl-6-(prop-2-enylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-phenyl-6-(prop-2-enylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112852048 |
| Molecular Formula | C20H16ClFN4O |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-phenyl-6-(prop-2-enylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNc1cc(C(=O)Nc2ccc(F)c(Cl)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H16ClFN4O/c1-2-10-23-18-12-17(25-19(26-18)13-6-4-3-5-7-13)20(27)24-14-8-9-16(22)15(21)11-14/h2-9,11-12H,1,10H2,(H,24,27)(H,23,25,26) |
| InChIKey | FBSVNRSXKWTIIF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|