C21H17F3N4O — CID 112852063
2-phenyl-6-(prop-2-enylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 112852063) has the molecular formula C21H17F3N4O and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-phenyl-6-(prop-2-enylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 2-phenyl-6-(prop-2-enylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112852063 |
| Molecular Formula | C21H17F3N4O |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-phenyl-6-(prop-2-enylamino)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | C=CCNc1cc(C(=O)Nc2cccc(C(F)(F)F)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H17F3N4O/c1-2-11-25-18-13-17(27-19(28-18)14-7-4-3-5-8-14)20(29)26-16-10-6-9-15(12-16)21(22,23)24/h2-10,12-13H,1,11H2,(H,26,29)(H,25,27,28) |
| InChIKey | KKPRPQVLCBWJTC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|