C21H22N4O2 — CID 112879673
4-N-(2,4-dimethoxyphenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 112879673) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-N-(2,4-dimethoxyphenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4-dimethoxyphenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879673 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-N-(2,4-dimethoxyphenyl)-2-phenyl-6-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1cc(Nc2ccc(OC)cc2OC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H22N4O2/c1-4-12-22-19-14-20(25-21(24-19)15-8-6-5-7-9-15)23-17-11-10-16(26-2)13-18(17)27-3/h4-11,13-14H,1,12H2,2-3H3,(H2,22,23,24,25) |
| InChIKey | QHQBCBUOBVZHCY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|