C22H22N4O2 — CID 112879698
ethyl 2-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112879698) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 2-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112879698 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl 2-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | C=CCNc1cc(Nc2ccccc2C(=O)OCC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H22N4O2/c1-3-14-23-19-15-20(26-21(25-19)16-10-6-5-7-11-16)24-18-13-9-8-12-17(18)22(27)28-4-2/h3,5-13,15H,1,4,14H2,2H3,(H2,23,24,25,26) |
| InChIKey | SPKQVLBHOIWOSG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|