C21H27N5O2 — CID 112879628
ethyl 4-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 112879628) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is ethyl 4-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112879628 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | ethyl 4-[[2-phenyl-6-(prop-2-enylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | C=CCNc1cc(NC2CCN(C(=O)OCC)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-12-22-18-15-19(25-20(24-18)16-8-6-5-7-9-16)23-17-10-13-26(14-11-17)21(27)28-4-2/h3,5-9,15,17H,1,4,10-14H2,2H3,(H2,22,23,24,25) |
| InChIKey | VREILDVPOHSJMG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|