C21H29N5O2 — CID 112873698
ethyl 4-[[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 112873698) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is ethyl 4-[[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112873698 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | ethyl 4-[[2-methyl-6-(2-phenylethylamino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cc(NCCc3ccccc3)nc(C)n2)CC1 |
| InChI | InChI=1S/C21H29N5O2/c1-3-28-21(27)26-13-10-18(11-14-26)25-20-15-19(23-16(2)24-20)22-12-9-17-7-5-4-6-8-17/h4-8,15,18H,3,9-14H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | ILXVXTZBUHFCAQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |