C22H24N4O3 — CID 112879695
2-phenyl-6-N-prop-2-enyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 112879695) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-phenyl-6-N-prop-2-enyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-phenyl-6-N-prop-2-enyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879695 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-phenyl-6-N-prop-2-enyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | C=CCNc1cc(Nc2cc(OC)c(OC)c(OC)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H24N4O3/c1-5-11-23-19-14-20(26-22(25-19)15-9-7-6-8-10-15)24-16-12-17(27-2)21(29-4)18(13-16)28-3/h5-10,12-14H,1,11H2,2-4H3,(H2,23,24,25,26) |
| InChIKey | BWXIQWYUFGMKNR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|