C22H26N4O2 — CID 112879752
6-N-butyl-4-N-(2,4-dimethoxyphenyl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112879752) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 6-N-butyl-4-N-(2,4-dimethoxyphenyl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-butyl-4-N-(2,4-dimethoxyphenyl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879752 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 6-N-butyl-4-N-(2,4-dimethoxyphenyl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCCCNc1cc(Nc2ccc(OC)cc2OC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H26N4O2/c1-4-5-13-23-20-15-21(26-22(25-20)16-9-7-6-8-10-16)24-18-12-11-17(27-2)14-19(18)28-3/h6-12,14-15H,4-5,13H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | QOQCMKXLKDXSKJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|