C23H28N4O2 — CID 112879734
6-N-butyl-4-N-[(3,4-dimethoxyphenyl)methyl]-2-phenylpyrimidine-4,6-diamine (PubChem CID 112879734) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 6-N-butyl-4-N-[(3,4-dimethoxyphenyl)methyl]-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-butyl-4-N-[(3,4-dimethoxyphenyl)methyl]-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879734 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 6-N-butyl-4-N-[(3,4-dimethoxyphenyl)methyl]-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCCCNc1cc(NCc2ccc(OC)c(OC)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H28N4O2/c1-4-5-13-24-21-15-22(27-23(26-21)18-9-7-6-8-10-18)25-16-17-11-12-19(28-2)20(14-17)29-3/h6-12,14-15H,4-5,13,16H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | BTJYYXSSNLTMBK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|