C16H14Cl2N6OS — CID 87656190
1-[3-(3,5-dichloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea (PubChem CID 87656190) has the molecular formula C16H14Cl2N6OS and a molecular weight of 409.30 g/mol. Its IUPAC name is 1-[3-(3,5-dichloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea.
| Compound Name | 1-[3-(3,5-dichloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea |
|---|---|
| PubChem CID | 87656190 |
| Molecular Formula | C16H14Cl2N6OS |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 1-[3-(3,5-dichloroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea |
| SMILES | CCNC(=O)N(S)c1ccc2ncc(Nc3cc(Cl)cc(Cl)c3)nc2n1 |
| InChI | InChI=1S/C16H14Cl2N6OS/c1-2-19-16(25)24(26)14-4-3-12-15(23-14)22-13(8-20-12)21-11-6-9(17)5-10(18)7-11/h3-8,26H,2H2,1H3,(H,19,25)(H,21,22,23) |
| InChIKey | HDUOEWLTAGQDRZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|