C22H20N6OS — CID 87656267
3-ethyl-1-[3-(4-phenylanilino)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea (PubChem CID 87656267) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-ethyl-1-[3-(4-phenylanilino)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea.
| Compound Name | 3-ethyl-1-[3-(4-phenylanilino)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87656267 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-ethyl-1-[3-(4-phenylanilino)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea |
| SMILES | CCNC(=O)N(S)c1ccc2ncc(Nc3ccc(-c4ccccc4)cc3)nc2n1 |
| InChI | InChI=1S/C22H20N6OS/c1-2-23-22(29)28(30)20-13-12-18-21(27-20)26-19(14-24-18)25-17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-14,30H,2H2,1H3,(H,23,29)(H,25,26,27) |
| InChIKey | UHIFYGDPFKJGCD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|