C18H20INO2 — CID 165178410
tert-butyl N-(2-iodophenyl)-N-(4-methylphenyl)carbamate (PubChem CID 165178410) has the molecular formula C18H20INO2 and a molecular weight of 409.27 g/mol. Its IUPAC name is tert-butyl N-(2-iodophenyl)-N-(4-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(2-iodophenyl)-N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 165178410 |
| Molecular Formula | C18H20INO2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | tert-butyl N-(2-iodophenyl)-N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(N(C(=O)OC(C)(C)C)c2ccccc2I)cc1 |
| InChI | InChI=1S/C18H20INO2/c1-13-9-11-14(12-10-13)20(17(21)22-18(2,3)4)16-8-6-5-7-15(16)19/h5-12H,1-4H3 |
| InChIKey | IKYMGDLCHJJMJL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|