C15H18INO2 — CID 132516346
tert-butyl N-buta-2,3-dienyl-N-(2-iodophenyl)carbamate (PubChem CID 132516346) has the molecular formula C15H18INO2 and a molecular weight of 371.22 g/mol. Its IUPAC name is tert-butyl N-buta-2,3-dienyl-N-(2-iodophenyl)carbamate.
| Compound Name | tert-butyl N-buta-2,3-dienyl-N-(2-iodophenyl)carbamate |
|---|---|
| PubChem CID | 132516346 |
| Molecular Formula | C15H18INO2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | tert-butyl N-buta-2,3-dienyl-N-(2-iodophenyl)carbamate |
| SMILES | C=C=CCN(C(=O)OC(C)(C)C)c1ccccc1I |
| InChI | InChI=1S/C15H18INO2/c1-5-6-11-17(14(18)19-15(2,3)4)13-10-8-7-9-12(13)16/h6-10H,1,11H2,2-4H3 |
| InChIKey | QWCVQSMNLYOGEW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|