C18H18I2N2O3 — CID 171397270
tert-butyl N-(2-iodophenyl)-N-[(2-iodophenyl)carbamoyl]carbamate (PubChem CID 171397270) has the molecular formula C18H18I2N2O3 and a molecular weight of 564.16 g/mol. Its IUPAC name is tert-butyl N-(2-iodophenyl)-N-[(2-iodophenyl)carbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-iodophenyl)-N-[(2-iodophenyl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 171397270 |
| Molecular Formula | C18H18I2N2O3 |
| Molecular Weight | 564.16 g/mol |
| Exact Mass | 563.94 |
| IUPAC Name | tert-butyl N-(2-iodophenyl)-N-[(2-iodophenyl)carbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)Nc1ccccc1I)c1ccccc1I |
| InChI | InChI=1S/C18H18I2N2O3/c1-18(2,3)25-17(24)22(15-11-7-5-9-13(15)20)16(23)21-14-10-6-4-8-12(14)19/h4-11H,1-3H3,(H,21,23) |
| InChIKey | OZYHNCBHTYSBJR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.16 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|