C18H18N4O7 — CID 10644787
tert-butyl N-(2-nitrophenyl)-N-[(2-nitrophenyl)carbamoyl]carbamate (PubChem CID 10644787) has the molecular formula C18H18N4O7 and a molecular weight of 402.36 g/mol. Its IUPAC name is tert-butyl N-(2-nitrophenyl)-N-[(2-nitrophenyl)carbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-nitrophenyl)-N-[(2-nitrophenyl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 10644787 |
| Molecular Formula | C18H18N4O7 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | tert-butyl N-(2-nitrophenyl)-N-[(2-nitrophenyl)carbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)Nc1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O7/c1-18(2,3)29-17(24)20(14-10-6-7-11-15(14)22(27)28)16(23)19-12-8-4-5-9-13(12)21(25)26/h4-11H,1-3H3,(H,19,23) |
| InChIKey | CCGXCCPITNFPJI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|