C33H31N3O6 — CID 176729821
9H-fluoren-9-ylmethyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-N-[(2-nitrophenyl)methyl]carbamate (PubChem CID 176729821) has the molecular formula C33H31N3O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-N-[(2-nitrophenyl)methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-N-[(2-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 176729821 |
| Molecular Formula | C33H31N3O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-N-[(2-nitrophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1N(Cc1ccccc1[N+](=O)[O-])C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H31N3O6/c1-33(2,3)42-31(37)34-28-17-9-11-19-30(28)35(20-22-12-4-10-18-29(22)36(39)40)32(38)41-21-27-25-15-7-5-13-23(25)24-14-6-8-16-26(24)27/h4-19,27H,20-21H2,1-3H3,(H,34,37) |
| InChIKey | FORWDGDUGXXPAT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|