C25H28N2O6 — CID 70003843
[5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-2-(2-phenylethynyl)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 70003843) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is [5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-2-(2-phenylethynyl)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-2-(2-phenylethynyl)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 70003843 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-2-(2-phenylethynyl)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(COC(=O)C(C)(C)C)c(C#Cc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H28N2O6/c1-24(2,3)22(28)32-16-19-14-20(26-23(29)33-25(4,5)6)21(27(30)31)15-18(19)13-12-17-10-8-7-9-11-17/h7-11,14-15H,16H2,1-6H3,(H,26,29) |
| InChIKey | OZYRIZIQTZRXDS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|