C14H20IN3O4 — CID 70003417
tert-butyl N-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]carbamate (PubChem CID 70003417) has the molecular formula C14H20IN3O4 and a molecular weight of 421.24 g/mol. Its IUPAC name is tert-butyl N-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 70003417 |
| Molecular Formula | C14H20IN3O4 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | tert-butyl N-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]carbamate |
| SMILES | CN(C)Cc1cc(NC(=O)OC(C)(C)C)c([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C14H20IN3O4/c1-14(2,3)22-13(19)16-11-6-9(8-17(4)5)10(15)7-12(11)18(20)21/h6-7H,8H2,1-5H3,(H,16,19) |
| InChIKey | OQQPGLBAZSIFQX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|