C14H20IN3O4 — CID 151666610
[1-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 151666610) has the molecular formula C14H20IN3O4 and a molecular weight of 421.24 g/mol. Its IUPAC name is [1-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 151666610 |
| Molecular Formula | C14H20IN3O4 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | [1-[5-[(dimethylamino)methyl]-4-iodo-2-nitrophenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CN(C)Cc1cc(CC(C)(C)OC(N)=O)c([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C14H20IN3O4/c1-14(2,22-13(16)19)7-9-5-10(8-17(3)4)11(15)6-12(9)18(20)21/h5-6H,7-8H2,1-4H3,(H2,16,19) |
| InChIKey | QXQVXRBHMNYVSS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|