C13H15F3N2O4 — CID 150923169
[2-methyl-1-[4-methyl-2-nitro-5-(trifluoromethyl)phenyl]propan-2-yl] carbamate (PubChem CID 150923169) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is [2-methyl-1-[4-methyl-2-nitro-5-(trifluoromethyl)phenyl]propan-2-yl] carbamate.
| Compound Name | [2-methyl-1-[4-methyl-2-nitro-5-(trifluoromethyl)phenyl]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 150923169 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [2-methyl-1-[4-methyl-2-nitro-5-(trifluoromethyl)phenyl]propan-2-yl] carbamate |
| SMILES | Cc1cc([N+](=O)[O-])c(CC(C)(C)OC(N)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O4/c1-7-4-10(18(20)21)8(5-9(7)13(14,15)16)6-12(2,3)22-11(17)19/h4-5H,6H2,1-3H3,(H2,17,19) |
| InChIKey | LELOGTLZUROGGZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|