C11H12F3NO3 — CID 155581608
1,2-dimethyl-4-nitro-5-(2,2,2-trifluoroethoxymethyl)benzene (PubChem CID 155581608) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is 1,2-dimethyl-4-nitro-5-(2,2,2-trifluoroethoxymethyl)benzene.
| Compound Name | 1,2-dimethyl-4-nitro-5-(2,2,2-trifluoroethoxymethyl)benzene |
|---|---|
| PubChem CID | 155581608 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1,2-dimethyl-4-nitro-5-(2,2,2-trifluoroethoxymethyl)benzene |
| SMILES | Cc1cc(COCC(F)(F)F)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C11H12F3NO3/c1-7-3-9(5-18-6-11(12,13)14)10(15(16)17)4-8(7)2/h3-4H,5-6H2,1-2H3 |
| InChIKey | CZRMVJQTKYBBSD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|