C14H17F2NO3 — CID 155581543
1-[(2,2-difluoro-3-methylbut-3-enoxy)methyl]-4,5-dimethyl-2-nitrobenzene (PubChem CID 155581543) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-[(2,2-difluoro-3-methylbut-3-enoxy)methyl]-4,5-dimethyl-2-nitrobenzene.
| Compound Name | 1-[(2,2-difluoro-3-methylbut-3-enoxy)methyl]-4,5-dimethyl-2-nitrobenzene |
|---|---|
| PubChem CID | 155581543 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[(2,2-difluoro-3-methylbut-3-enoxy)methyl]-4,5-dimethyl-2-nitrobenzene |
| SMILES | C=C(C)C(F)(F)COCc1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17F2NO3/c1-9(2)14(15,16)8-20-7-12-5-10(3)11(4)6-13(12)17(18)19/h5-6H,1,7-8H2,2-4H3 |
| InChIKey | FRKWYSFEOXOEIV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|