C11H13F2NO3 — CID 155580536
2-(2,2-difluoropropoxymethyl)-4-methyl-1-nitrobenzene (PubChem CID 155580536) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-(2,2-difluoropropoxymethyl)-4-methyl-1-nitrobenzene.
| Compound Name | 2-(2,2-difluoropropoxymethyl)-4-methyl-1-nitrobenzene |
|---|---|
| PubChem CID | 155580536 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(2,2-difluoropropoxymethyl)-4-methyl-1-nitrobenzene |
| SMILES | Cc1ccc([N+](=O)[O-])c(COCC(C)(F)F)c1 |
| InChI | InChI=1S/C11H13F2NO3/c1-8-3-4-10(14(15)16)9(5-8)6-17-7-11(2,12)13/h3-5H,6-7H2,1-2H3 |
| InChIKey | LEFYVDCXJBBPRN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|