C15H10F5NO3 — CID 155580354
1,2,3,4,5-pentafluoro-6-[(4-methyl-2-nitrophenyl)methoxymethyl]benzene (PubChem CID 155580354) has the molecular formula C15H10F5NO3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(4-methyl-2-nitrophenyl)methoxymethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(4-methyl-2-nitrophenyl)methoxymethyl]benzene |
|---|---|
| PubChem CID | 155580354 |
| Molecular Formula | C15H10F5NO3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(4-methyl-2-nitrophenyl)methoxymethyl]benzene |
| SMILES | Cc1ccc(COCc2c(F)c(F)c(F)c(F)c2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10F5NO3/c1-7-2-3-8(10(4-7)21(22)23)5-24-6-9-11(16)13(18)15(20)14(19)12(9)17/h2-4H,5-6H2,1H3 |
| InChIKey | VLGYJYXFRVLJIH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|