About CID 150407142
CID 150407142 (PubChem CID 150407142) has the molecular formula C9H10NO4Si
and a molecular weight of 224.27 g/mol.
Molecular Properties
| Compound Name | CID 150407142 |
| PubChem CID | 150407142 |
| Molecular Formula | C9H10NO4Si |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | — |
| SMILES | COc1cc([N+](=O)[O-])c(CO[Si])cc1C |
| InChI | InChI=1S/C9H10NO4Si/c1-6-3-7(5-14-15)8(10(11)12)4-9(6)13-2/h3-4H,5H2,1-2H3 |
| InChIKey | UHFKFUXQCGDHNL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 150407142 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150407142?
The IUPAC name of CID 150407142 (CID 150407142) is not available.
What is the SMILES notation for CID 150407142?
The canonical SMILES for CID 150407142 is COc1cc([N+](=O)[O-])c(CO[Si])cc1C.
What is the InChIKey of CID 150407142?
The InChIKey is UHFKFUXQCGDHNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10NO4Si/c1-6-3-7(5-14-15)8(10(11)12)4-9(6)13-2/h3-4H,5H2,1-2H3.
What are the key properties of CID 150407142?
CID 150407142 has a molecular weight of 224.27 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150407142 is sourced from PubChem (CID 150407142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).