C10H11F3N2O3 — CID 107352087
N-methyl-2-nitro-6-(2,2,2-trifluoroethoxymethyl)aniline (PubChem CID 107352087) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is N-methyl-2-nitro-6-(2,2,2-trifluoroethoxymethyl)aniline.
| Compound Name | N-methyl-2-nitro-6-(2,2,2-trifluoroethoxymethyl)aniline |
|---|---|
| PubChem CID | 107352087 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-methyl-2-nitro-6-(2,2,2-trifluoroethoxymethyl)aniline |
| SMILES | CNc1c(COCC(F)(F)F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11F3N2O3/c1-14-9-7(5-18-6-10(11,12)13)3-2-4-8(9)15(16)17/h2-4,14H,5-6H2,1H3 |
| InChIKey | IWZARXHHRRWQNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|