C11H11ClF3NO5 — CID 106705225
1-(chloromethyl)-5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene (PubChem CID 106705225) has the molecular formula C11H11ClF3NO5 and a molecular weight of 329.66 g/mol. Its IUPAC name is 1-(chloromethyl)-5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene.
| Compound Name | 1-(chloromethyl)-5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene |
|---|---|
| PubChem CID | 106705225 |
| Molecular Formula | C11H11ClF3NO5 |
| Molecular Weight | 329.66 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 1-(chloromethyl)-5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene |
| SMILES | COc1cc(CCl)c([N+](=O)[O-])cc1OCOCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO5/c1-19-9-2-7(4-12)8(16(17)18)3-10(9)21-6-20-5-11(13,14)15/h2-3H,4-6H2,1H3 |
| InChIKey | VZDGLLGLEVSMGN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|