About tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline
tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 158099083) has the molecular formula C22H35F3N2O4
and a molecular weight of 448.53 g/mol. Its IUPAC name is tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline |
| PubChem CID | 158099083 |
| Molecular Formula | C22H35F3N2O4 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CCCCCCCCCC(=O)OC(C)(C)C.Cc1cc(N)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C14H28O2.C8H7F3N2O2/c1-5-6-7-8-9-10-11-12-13(15)16-14(2,3)4;1-4-2-6(12)7(13(14)15)3-5(4)8(9,10)11/h5-12H2,1-4H3;2-3H,12H2,1H3 |
| InChIKey | FPAOHIRWMXDEEZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline?
The IUPAC name of tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline (CID 158099083) is tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline.
What is the SMILES notation for tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline?
The canonical SMILES for tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline is CCCCCCCCCC(=O)OC(C)(C)C.Cc1cc(N)c([N+](=O)[O-])cc1C(F)(F)F.
What is the InChIKey of tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline?
The InChIKey is FPAOHIRWMXDEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C8H7F3N2O2/c1-5-6-7-8-9-10-11-12-13(15)16-14(2,3)4;1-4-2-6(12)7(13(14)15)3-5(4)8(9,10)11/h5-12H2,1-4H3;2-3H,12H2,1H3.
What are the key properties of tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline?
tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline has a molecular weight of 448.53 g/mol, XLogP of 6.97, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl decanoate;5-methyl-2-nitro-4-(trifluoromethyl)aniline is sourced from PubChem (CID 158099083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).