C17H28N2O3 — CID 174471009
[1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 174471009) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is [1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 174471009 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | Cc1ccc(OCCCN(C)C)c(CC(C)(C)OC(N)=O)c1 |
| InChI | InChI=1S/C17H28N2O3/c1-13-7-8-15(21-10-6-9-19(4)5)14(11-13)12-17(2,3)22-16(18)20/h7-8,11H,6,9-10,12H2,1-5H3,(H2,18,20) |
| InChIKey | LNYMTPIEQMEWQD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|