C17H23IN2O6 — CID 70002017
tert-butyl N-[4-iodo-2-nitro-5-(oxan-2-yloxymethyl)phenyl]carbamate (PubChem CID 70002017) has the molecular formula C17H23IN2O6 and a molecular weight of 478.28 g/mol. Its IUPAC name is tert-butyl N-[4-iodo-2-nitro-5-(oxan-2-yloxymethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-iodo-2-nitro-5-(oxan-2-yloxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 70002017 |
| Molecular Formula | C17H23IN2O6 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | tert-butyl N-[4-iodo-2-nitro-5-(oxan-2-yloxymethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(COC2CCCCO2)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23IN2O6/c1-17(2,3)26-16(21)19-13-8-11(12(18)9-14(13)20(22)23)10-25-15-6-4-5-7-24-15/h8-9,15H,4-7,10H2,1-3H3,(H,19,21) |
| InChIKey | IKCTXPQRUMWURD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|