C14H19IN2O6 — CID 70002363
tert-butyl N-[4-iodo-5-(2-methoxyethoxy)-2-nitrophenyl]carbamate (PubChem CID 70002363) has the molecular formula C14H19IN2O6 and a molecular weight of 438.22 g/mol. Its IUPAC name is tert-butyl N-[4-iodo-5-(2-methoxyethoxy)-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[4-iodo-5-(2-methoxyethoxy)-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 70002363 |
| Molecular Formula | C14H19IN2O6 |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | tert-butyl N-[4-iodo-5-(2-methoxyethoxy)-2-nitrophenyl]carbamate |
| SMILES | COCCOc1cc(NC(=O)OC(C)(C)C)c([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C14H19IN2O6/c1-14(2,3)23-13(18)16-10-8-12(22-6-5-21-4)9(15)7-11(10)17(19)20/h7-8H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | RODXWLBCSMJAHE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|