C14H18N2O7 — CID 139995177
methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrophenoxy]acetate (PubChem CID 139995177) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrophenoxy]acetate.
| Compound Name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 139995177 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N2O7/c1-14(2,3)23-13(18)15-10-6-5-9(7-11(10)16(19)20)22-8-12(17)21-4/h5-7H,8H2,1-4H3,(H,15,18) |
| InChIKey | OGGYKNDUVVRCHI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|