C20H23N3O6 — CID 18870365
N-[3-[2-(4-methoxy-2-nitroanilino)-2-oxoethoxy]phenyl]-2,2-dimethylpropanamide (PubChem CID 18870365) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[3-[2-(4-methoxy-2-nitroanilino)-2-oxoethoxy]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[2-(4-methoxy-2-nitroanilino)-2-oxoethoxy]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18870365 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[3-[2-(4-methoxy-2-nitroanilino)-2-oxoethoxy]phenyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(NC(=O)COc2cccc(NC(=O)C(C)(C)C)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23N3O6/c1-20(2,3)19(25)21-13-6-5-7-15(10-13)29-12-18(24)22-16-9-8-14(28-4)11-17(16)23(26)27/h5-11H,12H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | DNKPCZAQQODUIK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|