C23H22N2O6 — CID 18870453
2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 18870453) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 18870453 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(Oc3cc(C)cc(C)c3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N2O6/c1-15-10-16(2)12-20(11-15)31-18-6-4-17(5-7-18)30-14-23(26)24-21-9-8-19(29-3)13-22(21)25(27)28/h4-13H,14H2,1-3H3,(H,24,26) |
| InChIKey | ZZPDBWPLBIIYCS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|