C23H26N2O5 — CID 102431953
tert-butyl N-[4-[3-methyl-3-[(2-nitrophenyl)methoxy]but-1-ynyl]phenyl]carbamate (PubChem CID 102431953) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is tert-butyl N-[4-[3-methyl-3-[(2-nitrophenyl)methoxy]but-1-ynyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-methyl-3-[(2-nitrophenyl)methoxy]but-1-ynyl]phenyl]carbamate |
|---|---|
| PubChem CID | 102431953 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | tert-butyl N-[4-[3-methyl-3-[(2-nitrophenyl)methoxy]but-1-ynyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C#CC(C)(C)OCc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-22(2,3)30-21(26)24-19-12-10-17(11-13-19)14-15-23(4,5)29-16-18-8-6-7-9-20(18)25(27)28/h6-13H,16H2,1-5H3,(H,24,26) |
| InChIKey | TWFRJLMHLJRVHN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|