C16H16N2O6 — CID 132556756
(2-nitrophenyl)methyl N-[4-(1,2-dihydroxyethyl)phenyl]carbamate (PubChem CID 132556756) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is (2-nitrophenyl)methyl N-[4-(1,2-dihydroxyethyl)phenyl]carbamate.
| Compound Name | (2-nitrophenyl)methyl N-[4-(1,2-dihydroxyethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 132556756 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (2-nitrophenyl)methyl N-[4-(1,2-dihydroxyethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C(O)CO)cc1)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O6/c19-9-15(20)11-5-7-13(8-6-11)17-16(21)24-10-12-3-1-2-4-14(12)18(22)23/h1-8,15,19-20H,9-10H2,(H,17,21) |
| InChIKey | ZUYUTAFSYNYIHE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|