C22H16N6O12 — CID 90355387
(2,6-dinitrophenyl)methyl N-[4-[(2,6-dinitrophenyl)methoxycarbonylamino]phenyl]carbamate (PubChem CID 90355387) has the molecular formula C22H16N6O12 and a molecular weight of 556.40 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methyl N-[4-[(2,6-dinitrophenyl)methoxycarbonylamino]phenyl]carbamate.
| Compound Name | (2,6-dinitrophenyl)methyl N-[4-[(2,6-dinitrophenyl)methoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 90355387 |
| Molecular Formula | C22H16N6O12 |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | (2,6-dinitrophenyl)methyl N-[4-[(2,6-dinitrophenyl)methoxycarbonylamino]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(NC(=O)OCc2c([N+](=O)[O-])cccc2[N+](=O)[O-])cc1)OCc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N6O12/c29-21(39-11-15-17(25(31)32)3-1-4-18(15)26(33)34)23-13-7-9-14(10-8-13)24-22(30)40-12-16-19(27(35)36)5-2-6-20(16)28(37)38/h1-10H,11-12H2,(H,23,29)(H,24,30) |
| InChIKey | QRRQJMKWOMMVIG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 249.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|