C11H10N2O6 — CID 88709491
(2,6-dinitrophenyl)methyl 2-methylprop-2-enoate (PubChem CID 88709491) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methyl 2-methylprop-2-enoate.
| Compound Name | (2,6-dinitrophenyl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88709491 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (2,6-dinitrophenyl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N2O6/c1-7(2)11(14)19-6-8-9(12(15)16)4-3-5-10(8)13(17)18/h3-5H,1,6H2,2H3 |
| InChIKey | ZMZDDKOFZYVMQA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|