C15H5F15N2O6 — CID 18381182
(2,6-dinitrophenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (PubChem CID 18381182) has the molecular formula C15H5F15N2O6 and a molecular weight of 594.18 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate.
| Compound Name | (2,6-dinitrophenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
|---|---|
| PubChem CID | 18381182 |
| Molecular Formula | C15H5F15N2O6 |
| Molecular Weight | 594.18 g/mol |
| Exact Mass | 593.99 |
| IUPAC Name | (2,6-dinitrophenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| SMILES | O=C(OCc1c([N+](=O)[O-])cccc1[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H5F15N2O6/c16-9(17,8(33)38-4-5-6(31(34)35)2-1-3-7(5)32(36)37)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h1-3H,4H2 |
| InChIKey | AYRKOTYRXGOACX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.18 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|