C16H23N3O6 — CID 58710937
(2,6-dinitrophenyl)methyl N,N-dibutylcarbamate (PubChem CID 58710937) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methyl N,N-dibutylcarbamate.
| Compound Name | (2,6-dinitrophenyl)methyl N,N-dibutylcarbamate |
|---|---|
| PubChem CID | 58710937 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2,6-dinitrophenyl)methyl N,N-dibutylcarbamate |
| SMILES | CCCCN(CCCC)C(=O)OCc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O6/c1-3-5-10-17(11-6-4-2)16(20)25-12-13-14(18(21)22)8-7-9-15(13)19(23)24/h7-9H,3-6,10-12H2,1-2H3 |
| InChIKey | OSGACJWSJJLRRE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|