C22H36N2O4 — CID 122693836
(2-nitrophenyl)methyl N,N-di(heptan-2-yl)carbamate (PubChem CID 122693836) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2-nitrophenyl)methyl N,N-di(heptan-2-yl)carbamate.
| Compound Name | (2-nitrophenyl)methyl N,N-di(heptan-2-yl)carbamate |
|---|---|
| PubChem CID | 122693836 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (2-nitrophenyl)methyl N,N-di(heptan-2-yl)carbamate |
| SMILES | CCCCCC(C)N(C(=O)OCc1ccccc1[N+](=O)[O-])C(C)CCCCC |
| InChI | InChI=1S/C22H36N2O4/c1-5-7-9-13-18(3)23(19(4)14-10-8-6-2)22(25)28-17-20-15-11-12-16-21(20)24(26)27/h11-12,15-16,18-19H,5-10,13-14,17H2,1-4H3 |
| InChIKey | NJXACKPKVNPSFX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|