About [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate
[ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate (PubChem CID 175027742) has the molecular formula C12H15N3O6
and a molecular weight of 297.27 g/mol. Its IUPAC name is [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate.
Molecular Properties
| Compound Name | [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate |
| PubChem CID | 175027742 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate |
| SMILES | CCN(OC(=O)CN)C(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O6/c1-2-14(21-11(16)7-13)12(17)20-8-9-5-3-4-6-10(9)15(18)19/h3-6H,2,7-8,13H2,1H3 |
| InChIKey | ZSAKUGHNKZVOOF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate?
The IUPAC name of [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate (CID 175027742) is [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate.
What is the SMILES notation for [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate?
The canonical SMILES for [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate is CCN(OC(=O)CN)C(=O)OCc1ccccc1[N+](=O)[O-].
What is the InChIKey of [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate?
The InChIKey is ZSAKUGHNKZVOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O6/c1-2-14(21-11(16)7-13)12(17)20-8-9-5-3-4-6-10(9)15(18)19/h3-6H,2,7-8,13H2,1H3.
What are the key properties of [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate?
[ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate has a molecular weight of 297.27 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl-[(2-nitrophenyl)methoxycarbonyl]amino] 2-aminoacetate is sourced from PubChem (CID 175027742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).