C12H8F7NO5 — CID 91703794
(3-methoxy-4-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91703794) has the molecular formula C12H8F7NO5 and a molecular weight of 379.18 g/mol. Its IUPAC name is (3-methoxy-4-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (3-methoxy-4-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91703794 |
| Molecular Formula | C12H8F7NO5 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | (3-methoxy-4-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | COc1cc(COC(=O)C(F)(F)C(F)(F)C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8F7NO5/c1-24-8-4-6(2-3-7(8)20(22)23)5-25-9(21)10(13,14)11(15,16)12(17,18)19/h2-4H,5H2,1H3 |
| InChIKey | JYOQQFHNMLQSEM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|