C11H5F8NO4 — CID 91721513
(2-fluoro-5-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91721513) has the molecular formula C11H5F8NO4 and a molecular weight of 367.15 g/mol. Its IUPAC name is (2-fluoro-5-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (2-fluoro-5-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91721513 |
| Molecular Formula | C11H5F8NO4 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | (2-fluoro-5-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])ccc1F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F8NO4/c12-7-2-1-6(20(22)23)3-5(7)4-24-8(21)9(13,14)10(15,16)11(17,18)19/h1-3H,4H2 |
| InChIKey | NQNKCIJPYSMAQY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|