C10H5ClF5NO4 — CID 91725558
(2-chloro-5-nitrophenyl)methyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91725558) has the molecular formula C10H5ClF5NO4 and a molecular weight of 333.60 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)methyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (2-chloro-5-nitrophenyl)methyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91725558 |
| Molecular Formula | C10H5ClF5NO4 |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | (2-chloro-5-nitrophenyl)methyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])ccc1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5ClF5NO4/c11-7-2-1-6(17(19)20)3-5(7)4-21-8(18)9(12,13)10(14,15)16/h1-3H,4H2 |
| InChIKey | ZNUKLVMFNQCMPC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|